C4F8S — CID 12705729
2,2,3,3,4,4,5,5-octafluorothiolane (PubChem CID 12705729) has the molecular formula C4F8S and a molecular weight of 232.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluorothiolane.
| Compound Name | 2,2,3,3,4,4,5,5-octafluorothiolane |
|---|---|
| PubChem CID | 12705729 |
| Molecular Formula | C4F8S |
| Molecular Weight | 232.09 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluorothiolane |
| SMILES | FC1(F)SC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F8S/c5-1(6)2(7,8)4(11,12)13-3(1,9)10 |
| InChIKey | JUTLAXFVSZJSHM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.09 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|