C11H20F2 — CID 144730530
4,4-difluoro-3,3,5,5-tetramethylcyclopentene;ethane (PubChem CID 144730530) has the molecular formula C11H20F2 and a molecular weight of 190.28 g/mol. Its IUPAC name is 4,4-difluoro-3,3,5,5-tetramethylcyclopentene;ethane.
| Compound Name | 4,4-difluoro-3,3,5,5-tetramethylcyclopentene;ethane |
|---|---|
| PubChem CID | 144730530 |
| Molecular Formula | C11H20F2 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4,4-difluoro-3,3,5,5-tetramethylcyclopentene;ethane |
| SMILES | CC.CC1(C)C=CC(C)(C)C1(F)F |
| InChI | InChI=1S/C9H14F2.C2H6/c1-7(2)5-6-8(3,4)9(7,10)11;1-2/h5-6H,1-4H3;1-2H3 |
| InChIKey | JTMVKFIHMARCTQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|