C19H38 — CID 144805565
4,4-ditert-butyl-3,3,5,5-tetramethylcyclopentene;ethane (PubChem CID 144805565) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is 4,4-ditert-butyl-3,3,5,5-tetramethylcyclopentene;ethane.
| Compound Name | 4,4-ditert-butyl-3,3,5,5-tetramethylcyclopentene;ethane |
|---|---|
| PubChem CID | 144805565 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 4,4-ditert-butyl-3,3,5,5-tetramethylcyclopentene;ethane |
| SMILES | CC.CC(C)(C)C1(C(C)(C)C)C(C)(C)C=CC1(C)C |
| InChI | InChI=1S/C17H32.C2H6/c1-13(2,3)17(14(4,5)6)15(7,8)11-12-16(17,9)10;1-2/h11-12H,1-10H3;1-2H3 |
| InChIKey | CIKUZTVRQXPPLT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|