C10BrF11 — CID 12521074
2-bromo-1,1,2,3,3,4,4,5,6,7,8-undecafluoronaphthalene (PubChem CID 12521074) has the molecular formula C10BrF11 and a molecular weight of 408.99 g/mol. Its IUPAC name is 2-bromo-1,1,2,3,3,4,4,5,6,7,8-undecafluoronaphthalene.
| Compound Name | 2-bromo-1,1,2,3,3,4,4,5,6,7,8-undecafluoronaphthalene |
|---|---|
| PubChem CID | 12521074 |
| Molecular Formula | C10BrF11 |
| Molecular Weight | 408.99 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | 2-bromo-1,1,2,3,3,4,4,5,6,7,8-undecafluoronaphthalene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C(F)(Br)C2(F)F |
| InChI | InChI=1S/C10BrF11/c11-9(20)7(16,17)1-2(8(18,19)10(9,21)22)4(13)6(15)5(14)3(1)12 |
| InChIKey | YXHWOGKKKICYFW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.99 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|