C9H2F9P — CID 134333725
(1,1,2,2,3,3,5,6,7-nonafluoroinden-4-yl)phosphane (PubChem CID 134333725) has the molecular formula C9H2F9P and a molecular weight of 312.07 g/mol. Its IUPAC name is (1,1,2,2,3,3,5,6,7-nonafluoroinden-4-yl)phosphane.
| Compound Name | (1,1,2,2,3,3,5,6,7-nonafluoroinden-4-yl)phosphane |
|---|---|
| PubChem CID | 134333725 |
| Molecular Formula | C9H2F9P |
| Molecular Weight | 312.07 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | (1,1,2,2,3,3,5,6,7-nonafluoroinden-4-yl)phosphane |
| SMILES | Fc1c(F)c(P)c2c(c1F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C9H2F9P/c10-3-1-2(6(19)5(12)4(3)11)8(15,16)9(17,18)7(1,13)14/h19H2 |
| InChIKey | KODRKGTZQNERLO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.07 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|