C9F10 — CID 12566761
2,3,4,5,7,7,8-heptafluoro-8-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 12566761) has the molecular formula C9F10 and a molecular weight of 298.08 g/mol. Its IUPAC name is 2,3,4,5,7,7,8-heptafluoro-8-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 2,3,4,5,7,7,8-heptafluoro-8-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 12566761 |
| Molecular Formula | C9F10 |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2,3,4,5,7,7,8-heptafluoro-8-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(F)C2(F)C(F)(F)F |
| InChI | InChI=1S/C9F10/c10-3-1-2(4(11)6(13)5(3)12)8(15,16)7(1,14)9(17,18)19 |
| InChIKey | WQJWXJSNFCWJFR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|