C16HF15O — CID 626457
2,3,4,5,8,8-hexafluoro-7-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (PubChem CID 626457) has the molecular formula C16HF15O and a molecular weight of 494.15 g/mol. Its IUPAC name is 2,3,4,5,8,8-hexafluoro-7-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
| Compound Name | 2,3,4,5,8,8-hexafluoro-7-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
|---|---|
| PubChem CID | 626457 |
| Molecular Formula | C16HF15O |
| Molecular Weight | 494.15 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 2,3,4,5,8,8-hexafluoro-7-[1,1,2,2-tetrafluoro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| SMILES | OC1(C(F)(F)C(F)(F)c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2C1(F)F |
| InChI | InChI=1S/C16HF15O/c17-4-1-2(5(18)9(22)8(4)21)14(26,27)13(1,32)16(30,31)15(28,29)3-6(19)10(23)12(25)11(24)7(3)20/h32H |
| InChIKey | ZVNKSTFGMKOISN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.15 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|