C11F12 — CID 5378372
(3E)-1,1,2,2,4,5,6,7-octafluoro-3-(1,2,2,2-tetrafluoroethylidene)indene (PubChem CID 5378372) has the molecular formula C11F12 and a molecular weight of 360.10 g/mol. Its IUPAC name is (3E)-1,1,2,2,4,5,6,7-octafluoro-3-(1,2,2,2-tetrafluoroethylidene)indene.
| Compound Name | (3E)-1,1,2,2,4,5,6,7-octafluoro-3-(1,2,2,2-tetrafluoroethylidene)indene |
|---|---|
| PubChem CID | 5378372 |
| Molecular Formula | C11F12 |
| Molecular Weight | 360.10 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | (3E)-1,1,2,2,4,5,6,7-octafluoro-3-(1,2,2,2-tetrafluoroethylidene)indene |
| SMILES | F/C(=C1\c2c(F)c(F)c(F)c(F)c2C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C11F12/c12-4-1-2(5(13)7(15)6(4)14)9(17,18)10(19,20)3(1)8(16)11(21,22)23/b8-3+ |
| InChIKey | YWKKQILMYVHRJG-FPYGCLRLSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.10 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|