C10Cl2F6O — CID 15517472
3-(dichloromethylidene)-2,2,4,5,6,7-hexafluoroinden-1-one (PubChem CID 15517472) has the molecular formula C10Cl2F6O and a molecular weight of 321.00 g/mol. Its IUPAC name is 3-(dichloromethylidene)-2,2,4,5,6,7-hexafluoroinden-1-one.
| Compound Name | 3-(dichloromethylidene)-2,2,4,5,6,7-hexafluoroinden-1-one |
|---|---|
| PubChem CID | 15517472 |
| Molecular Formula | C10Cl2F6O |
| Molecular Weight | 321.00 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 3-(dichloromethylidene)-2,2,4,5,6,7-hexafluoroinden-1-one |
| SMILES | O=C1c2c(F)c(F)c(F)c(F)c2C(=C(Cl)Cl)C1(F)F |
| InChI | InChI=1S/C10Cl2F6O/c11-9(12)3-1-2(8(19)10(3,17)18)5(14)7(16)6(15)4(1)13 |
| InChIKey | CACBJYRUBUGOQC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.00 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|