C13H2BF9O2 — CID 141039667
(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)boronic acid (PubChem CID 141039667) has the molecular formula C13H2BF9O2 and a molecular weight of 371.95 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)boronic acid.
| Compound Name | (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)boronic acid |
|---|---|
| PubChem CID | 141039667 |
| Molecular Formula | C13H2BF9O2 |
| Molecular Weight | 371.95 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)boronic acid |
| SMILES | OB(O)c1c(F)c(F)c(F)c2c1C(F)(F)c1c(F)c(F)c(F)c(F)c1-2 |
| InChI | InChI=1S/C13H2BF9O2/c15-6-1-2-4(8(17)12(21)11(20)7(2)16)13(22,23)3(1)5(14(24)25)9(18)10(6)19/h24-25H |
| InChIKey | COHRZEIAHXFIBV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.95 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|