C30BF23O2 — CID 141052417
bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane (PubChem CID 141052417) has the molecular formula C30BF23O2 and a molecular weight of 840.09 g/mol. Its IUPAC name is bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane.
| Compound Name | bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane |
|---|---|
| PubChem CID | 141052417 |
| Molecular Formula | C30BF23O2 |
| Molecular Weight | 840.09 g/mol |
| Exact Mass | 839.96 |
| IUPAC Name | bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane |
| SMILES | FC1=C(F)C(F)(OB(OC2(F)C(F)=C(F)c3c(F)c(F)c(F)c(F)c32)c2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C30BF23O2/c32-8-1(2-9(33)19(43)26(50)20(44)10(2)34)7(17(41)25(49)18(8)42)31(55-29(53)5-3(13(37)27(29)51)11(35)21(45)23(47)15(5)39)56-30(54)6-4(14(38)28(30)52)12(36)22(46)24(48)16(6)40 |
| InChIKey | KIRTWUKRXBIRJA-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.09 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|