C27BF21O2 — CID 141052288
(1,2,3,4,5,6,7-heptafluoroinden-1-yl)-bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]borane (PubChem CID 141052288) has the molecular formula C27BF21O2 and a molecular weight of 766.06 g/mol. Its IUPAC name is (1,2,3,4,5,6,7-heptafluoroinden-1-yl)-bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]borane.
| Compound Name | (1,2,3,4,5,6,7-heptafluoroinden-1-yl)-bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]borane |
|---|---|
| PubChem CID | 141052288 |
| Molecular Formula | C27BF21O2 |
| Molecular Weight | 766.06 g/mol |
| Exact Mass | 765.97 |
| IUPAC Name | (1,2,3,4,5,6,7-heptafluoroinden-1-yl)-bis[(1,2,3,4,5,6,7-heptafluoroinden-1-yl)oxy]borane |
| SMILES | FC1=C(F)C(F)(OB(OC2(F)C(F)=C(F)c3c(F)c(F)c(F)c(F)c32)C2(F)C(F)=C(F)c3c(F)c(F)c(F)c(F)c32)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C27BF21O2/c29-7-1-4(13(35)19(41)16(7)38)25(47,22(44)10(1)32)28(50-26(48)5-2(11(33)23(26)45)8(30)17(39)20(42)14(5)36)51-27(49)6-3(12(34)24(27)46)9(31)18(40)21(43)15(6)37 |
| InChIKey | OYMZKJSDPHTEKM-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.06 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|