C34BF25 — CID 141052222
(1,2,3,4,5,6,7-heptafluoroinden-1-yl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane (PubChem CID 141052222) has the molecular formula C34BF25 and a molecular weight of 894.14 g/mol. Its IUPAC name is (1,2,3,4,5,6,7-heptafluoroinden-1-yl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane.
| Compound Name | (1,2,3,4,5,6,7-heptafluoroinden-1-yl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane |
|---|---|
| PubChem CID | 141052222 |
| Molecular Formula | C34BF25 |
| Molecular Weight | 894.14 g/mol |
| Exact Mass | 893.97 |
| IUPAC Name | (1,2,3,4,5,6,7-heptafluoroinden-1-yl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]borane |
| SMILES | FC1=C(F)C(F)(B(c2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c3c2C(F)(F)c2c(F)c(F)c(F)c(F)c2-3)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C34BF25/c36-11-1-2-8(19(44)29(54)23(48)12(2)37)34(59,60)6(1)10(21(46)22(11)47)35(33(58)7-5(17(42)32(33)57)16(41)27(52)28(53)18(7)43)9-3(13(38)24(49)30(55)20(9)45)4-14(39)25(50)31(56)26(51)15(4)40 |
| InChIKey | XGCONJITOSPIRN-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.14 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|