C28H9F18NSi — CID 141042297
1,3,4,5,6,7,8,9,9-nonafluoro-N-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-N-trimethylsilylfluoren-2-amine (PubChem CID 141042297) has the molecular formula C28H9F18NSi and a molecular weight of 729.44 g/mol. Its IUPAC name is 1,3,4,5,6,7,8,9,9-nonafluoro-N-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-N-trimethylsilylfluoren-2-amine.
| Compound Name | 1,3,4,5,6,7,8,9,9-nonafluoro-N-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-N-trimethylsilylfluoren-2-amine |
|---|---|
| PubChem CID | 141042297 |
| Molecular Formula | C28H9F18NSi |
| Molecular Weight | 729.44 g/mol |
| Exact Mass | 729.02 |
| IUPAC Name | 1,3,4,5,6,7,8,9,9-nonafluoro-N-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-N-trimethylsilylfluoren-2-amine |
| SMILES | C[Si](C)(C)N(c1c(F)c(F)c2c(c1F)C(F)(F)c1c(F)c(F)c(F)c(F)c1-2)c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C28H9F18NSi/c1-48(2,3)47(26-7(14(33)20(39)23(42)25(26)44)6-12(31)18(37)22(41)19(38)13(6)32)27-16(35)9-5(11(30)24(27)43)4-8(28(9,45)46)15(34)21(40)17(36)10(4)29/h1-3H3 |
| InChIKey | ROBJOKYKHKCLDA-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.44 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|