C14H5F10N — CID 141039620
2,3,4,5-tetrafluoro-N-(fluoromethyl)-N-methyl-6-(2,3,4,5,6-pentafluorophenyl)aniline (PubChem CID 141039620) has the molecular formula C14H5F10N and a molecular weight of 377.18 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(fluoromethyl)-N-methyl-6-(2,3,4,5,6-pentafluorophenyl)aniline.
| Compound Name | 2,3,4,5-tetrafluoro-N-(fluoromethyl)-N-methyl-6-(2,3,4,5,6-pentafluorophenyl)aniline |
|---|---|
| PubChem CID | 141039620 |
| Molecular Formula | C14H5F10N |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(fluoromethyl)-N-methyl-6-(2,3,4,5,6-pentafluorophenyl)aniline |
| SMILES | CN(CF)c1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H5F10N/c1-25(2-15)14-4(7(18)10(21)12(23)13(14)24)3-5(16)8(19)11(22)9(20)6(3)17/h2H2,1H3 |
| InChIKey | QIOLGWFJFXAXPY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|