C13F12N2 — CID 23237267
5,6,7,8,9,9-hexafluoro-2,4-bis(trifluoromethyl)indeno[2,1-d]pyrimidine (PubChem CID 23237267) has the molecular formula C13F12N2 and a molecular weight of 412.13 g/mol. Its IUPAC name is 5,6,7,8,9,9-hexafluoro-2,4-bis(trifluoromethyl)indeno[2,1-d]pyrimidine.
| Compound Name | 5,6,7,8,9,9-hexafluoro-2,4-bis(trifluoromethyl)indeno[2,1-d]pyrimidine |
|---|---|
| PubChem CID | 23237267 |
| Molecular Formula | C13F12N2 |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 5,6,7,8,9,9-hexafluoro-2,4-bis(trifluoromethyl)indeno[2,1-d]pyrimidine |
| SMILES | Fc1c(F)c(F)c2c(c1F)-c1c(C(F)(F)F)nc(C(F)(F)F)nc1C2(F)F |
| InChI | InChI=1S/C13F12N2/c14-4-1-2-8(11(18,19)3(1)5(15)7(17)6(4)16)26-10(13(23,24)25)27-9(2)12(20,21)22 |
| InChIKey | NTWDTMWOBPFXIB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|