C13H2F11N — CID 165350362
3-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trifluoromethyl)pyridine (PubChem CID 165350362) has the molecular formula C13H2F11N and a molecular weight of 381.14 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trifluoromethyl)pyridine.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 165350362 |
| Molecular Formula | C13H2F11N |
| Molecular Weight | 381.14 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trifluoromethyl)pyridine |
| SMILES | Fc1c(F)c(F)c(-c2cc(C(F)(F)F)cnc2C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H2F11N/c14-6-5(7(15)9(17)10(18)8(6)16)4-1-3(12(19,20)21)2-25-11(4)13(22,23)24/h1-2H |
| InChIKey | QEDPSUKBDFZHOH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.14 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|