C12H2Cl5F4N — CID 133090076
3-fluoro-2-(2,3,4,5,6-pentachlorophenyl)-5-(trifluoromethyl)pyridine (PubChem CID 133090076) has the molecular formula C12H2Cl5F4N and a molecular weight of 413.41 g/mol. Its IUPAC name is 3-fluoro-2-(2,3,4,5,6-pentachlorophenyl)-5-(trifluoromethyl)pyridine.
| Compound Name | 3-fluoro-2-(2,3,4,5,6-pentachlorophenyl)-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 133090076 |
| Molecular Formula | C12H2Cl5F4N |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 410.86 |
| IUPAC Name | 3-fluoro-2-(2,3,4,5,6-pentachlorophenyl)-5-(trifluoromethyl)pyridine |
| SMILES | Fc1cc(C(F)(F)F)cnc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H2Cl5F4N/c13-6-5(7(14)9(16)10(17)8(6)15)11-4(18)1-3(2-22-11)12(19,20)21/h1-2H |
| InChIKey | YPWOZNROKMTNDT-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|