C12HCl5F5N — CID 118993970
2,4-difluoro-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine (PubChem CID 118993970) has the molecular formula C12HCl5F5N and a molecular weight of 431.40 g/mol. Its IUPAC name is 2,4-difluoro-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine.
| Compound Name | 2,4-difluoro-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 118993970 |
| Molecular Formula | C12HCl5F5N |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 428.85 |
| IUPAC Name | 2,4-difluoro-3-(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine |
| SMILES | Fc1cc(C(F)(F)F)nc(F)c1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12HCl5F5N/c13-6-5(7(14)9(16)10(17)8(6)15)4-2(18)1-3(12(20,21)22)23-11(4)19/h1H |
| InChIKey | YBZBWXIUJPJARC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|