C18HCl10F4N — CID 133089927
3-fluoro-2,4-bis(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine (PubChem CID 133089927) has the molecular formula C18HCl10F4N and a molecular weight of 661.73 g/mol. Its IUPAC name is 3-fluoro-2,4-bis(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine.
| Compound Name | 3-fluoro-2,4-bis(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 133089927 |
| Molecular Formula | C18HCl10F4N |
| Molecular Weight | 661.73 g/mol |
| Exact Mass | 656.69 |
| IUPAC Name | 3-fluoro-2,4-bis(2,3,4,5,6-pentachlorophenyl)-6-(trifluoromethyl)pyridine |
| SMILES | Fc1c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc(C(F)(F)F)nc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18HCl10F4N/c19-6-4(7(20)11(24)14(27)10(6)23)2-1-3(18(30,31)32)33-17(16(2)29)5-8(21)12(25)15(28)13(26)9(5)22/h1H |
| InChIKey | IVTJKWRNRJAAAL-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.73 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|