C23Cl15F2N — CID 133089949
3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentachlorophenyl)pyridine (PubChem CID 133089949) has the molecular formula C23Cl15F2N and a molecular weight of 860.05 g/mol. Its IUPAC name is 3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentachlorophenyl)pyridine.
| Compound Name | 3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentachlorophenyl)pyridine |
|---|---|
| PubChem CID | 133089949 |
| Molecular Formula | C23Cl15F2N |
| Molecular Weight | 860.05 g/mol |
| Exact Mass | 852.53 |
| IUPAC Name | 3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentachlorophenyl)pyridine |
| SMILES | Fc1c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)nc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(F)c1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C23Cl15F2N/c24-5-1(6(25)12(31)17(36)11(5)30)2-20(39)22(3-7(26)13(32)18(37)14(33)8(3)27)41-23(21(2)40)4-9(28)15(34)19(38)16(35)10(4)29 |
| InChIKey | UUEUKBIOYYWZEY-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.05 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|