About 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene
1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene (PubChem CID 175475336) has the molecular formula C18H10Cl3F
and a molecular weight of 351.64 g/mol. Its IUPAC name is 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene.
Molecular Properties
| Compound Name | 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene |
| PubChem CID | 175475336 |
| Molecular Formula | C18H10Cl3F |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene |
| SMILES | Fc1c(-c2ccccc2)c(Cl)c(Cl)c(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C18H10Cl3F/c19-15-13(11-7-3-1-4-8-11)18(22)14(16(20)17(15)21)12-9-5-2-6-10-12/h1-10H |
| InChIKey | OFDBSUOGTZCMJJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene?
The IUPAC name of 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene (CID 175475336) is 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene.
What is the SMILES notation for 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene?
The canonical SMILES for 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene is Fc1c(-c2ccccc2)c(Cl)c(Cl)c(Cl)c1-c1ccccc1.
What is the InChIKey of 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene?
The InChIKey is OFDBSUOGTZCMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl3F/c19-15-13(11-7-3-1-4-8-11)18(22)14(16(20)17(15)21)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene?
1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene has a molecular weight of 351.64 g/mol, XLogP of 7.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene is sourced from PubChem (CID 175475336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).