C18H10Cl3F — CID 175475336
1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene (PubChem CID 175475336) has the molecular formula C18H10Cl3F and a molecular weight of 351.64 g/mol. Its IUPAC name is 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene.
| Compound Name | 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene |
|---|---|
| PubChem CID | 175475336 |
| Molecular Formula | C18H10Cl3F |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1,2,3-trichloro-5-fluoro-4,6-diphenylbenzene |
| SMILES | Fc1c(-c2ccccc2)c(Cl)c(Cl)c(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C18H10Cl3F/c19-15-13(11-7-3-1-4-8-11)18(22)14(16(20)17(15)21)12-9-5-2-6-10-12/h1-10H |
| InChIKey | OFDBSUOGTZCMJJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|