C24H9Cl8F — CID 141060297
1,5-dichloro-3-fluoro-2-phenyl-6-(2,4,5-trichlorophenyl)-4-(2,4,6-trichlorophenyl)benzene (PubChem CID 141060297) has the molecular formula C24H9Cl8F and a molecular weight of 599.96 g/mol. Its IUPAC name is 1,5-dichloro-3-fluoro-2-phenyl-6-(2,4,5-trichlorophenyl)-4-(2,4,6-trichlorophenyl)benzene.
| Compound Name | 1,5-dichloro-3-fluoro-2-phenyl-6-(2,4,5-trichlorophenyl)-4-(2,4,6-trichlorophenyl)benzene |
|---|---|
| PubChem CID | 141060297 |
| Molecular Formula | C24H9Cl8F |
| Molecular Weight | 599.96 g/mol |
| Exact Mass | 595.82 |
| IUPAC Name | 1,5-dichloro-3-fluoro-2-phenyl-6-(2,4,5-trichlorophenyl)-4-(2,4,6-trichlorophenyl)benzene |
| SMILES | Fc1c(-c2ccccc2)c(Cl)c(-c2cc(Cl)c(Cl)cc2Cl)c(Cl)c1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C24H9Cl8F/c25-11-6-16(29)20(17(30)7-11)21-23(32)19(12-8-14(27)15(28)9-13(12)26)22(31)18(24(21)33)10-4-2-1-3-5-10/h1-9H |
| InChIKey | CVYREVKETKLBCV-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.96 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|