C18H3Cl11 — CID 25472
1,2,4,5-tetrachloro-3-(2,3,4,6-tetrachlorophenyl)-6-(2,4,5-trichlorophenyl)benzene (PubChem CID 25472) has the molecular formula C18H3Cl11 and a molecular weight of 609.21 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3-(2,3,4,6-tetrachlorophenyl)-6-(2,4,5-trichlorophenyl)benzene.
| Compound Name | 1,2,4,5-tetrachloro-3-(2,3,4,6-tetrachlorophenyl)-6-(2,4,5-trichlorophenyl)benzene |
|---|---|
| PubChem CID | 25472 |
| Molecular Formula | C18H3Cl11 |
| Molecular Weight | 609.21 g/mol |
| Exact Mass | 603.68 |
| IUPAC Name | 1,2,4,5-tetrachloro-3-(2,3,4,6-tetrachlorophenyl)-6-(2,4,5-trichlorophenyl)benzene |
| SMILES | Clc1cc(Cl)c(-c2c(Cl)c(Cl)c(-c3c(Cl)cc(Cl)c(Cl)c3Cl)c(Cl)c2Cl)cc1Cl |
| InChI | InChI=1S/C18H3Cl11/c19-5-2-7(21)6(20)1-4(5)10-14(25)17(28)12(18(29)15(10)26)11-8(22)3-9(23)13(24)16(11)27/h1-3H |
| InChIKey | DCWGVTFYEARJCZ-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.21 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|