C11H4Cl3F3N2 — CID 118847643
2-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrimidine (PubChem CID 118847643) has the molecular formula C11H4Cl3F3N2 and a molecular weight of 327.52 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 118847643 |
| Molecular Formula | C11H4Cl3F3N2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cnc(-c2cc(Cl)c(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C11H4Cl3F3N2/c12-7-1-5(2-8(13)9(7)14)10-18-3-6(4-19-10)11(15,16)17/h1-4H |
| InChIKey | VOMLPMWERMIBOG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|