C11H5Cl2F3N2 — CID 118830739
2-(3,5-dichlorophenyl)-5-(trifluoromethyl)pyrimidine (PubChem CID 118830739) has the molecular formula C11H5Cl2F3N2 and a molecular weight of 293.08 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-(3,5-dichlorophenyl)-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 118830739 |
| Molecular Formula | C11H5Cl2F3N2 |
| Molecular Weight | 293.08 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-5-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cnc(-c2cc(Cl)cc(Cl)c2)nc1 |
| InChI | InChI=1S/C11H5Cl2F3N2/c12-8-1-6(2-9(13)3-8)10-17-4-7(5-18-10)11(14,15)16/h1-5H |
| InChIKey | WJAWGMKOGOVFJM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.08 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |