C26H10F11N — CID 118920530
9-[2-(2,3,4,5,6-pentafluorophenyl)-4,6-bis(trifluoromethyl)phenyl]carbazole (PubChem CID 118920530) has the molecular formula C26H10F11N and a molecular weight of 545.35 g/mol. Its IUPAC name is 9-[2-(2,3,4,5,6-pentafluorophenyl)-4,6-bis(trifluoromethyl)phenyl]carbazole.
| Compound Name | 9-[2-(2,3,4,5,6-pentafluorophenyl)-4,6-bis(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 118920530 |
| Molecular Formula | C26H10F11N |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 9-[2-(2,3,4,5,6-pentafluorophenyl)-4,6-bis(trifluoromethyl)phenyl]carbazole |
| SMILES | Fc1c(F)c(F)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2-n2c3ccccc3c3ccccc32)c(F)c1F |
| InChI | InChI=1S/C26H10F11N/c27-19-18(20(28)22(30)23(31)21(19)29)14-9-11(25(32,33)34)10-15(26(35,36)37)24(14)38-16-7-3-1-5-12(16)13-6-2-4-8-17(13)38/h1-10H |
| InChIKey | LNXXYBVBCNQKCH-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|