C14H4F10 — CID 134620085
1-[2-(difluoromethyl)-5-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 134620085) has the molecular formula C14H4F10 and a molecular weight of 362.17 g/mol. Its IUPAC name is 1-[2-(difluoromethyl)-5-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[2-(difluoromethyl)-5-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 134620085 |
| Molecular Formula | C14H4F10 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-[2-(difluoromethyl)-5-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(-c2cc(C(F)(F)F)ccc2C(F)F)c(F)c1F |
| InChI | InChI=1S/C14H4F10/c15-8-7(9(16)11(18)12(19)10(8)17)6-3-4(14(22,23)24)1-2-5(6)13(20)21/h1-3,13H |
| InChIKey | ZUCJXRVNMUHNRX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|