C25H5F14Ga — CID 141052254
(2,3-difluorophenyl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-(2,3,4-trifluorophenyl)gallane (PubChem CID 141052254) has the molecular formula C25H5F14Ga and a molecular weight of 641.01 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-(2,3,4-trifluorophenyl)gallane.
| Compound Name | (2,3-difluorophenyl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-(2,3,4-trifluorophenyl)gallane |
|---|---|
| PubChem CID | 141052254 |
| Molecular Formula | C25H5F14Ga |
| Molecular Weight | 641.01 g/mol |
| Exact Mass | 639.94 |
| IUPAC Name | (2,3-difluorophenyl)-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-(2,3,4-trifluorophenyl)gallane |
| SMILES | Fc1cccc([Ga](c2ccc(F)c(F)c2F)c2c(F)c(F)c(F)c3c2C(F)(F)c2c(F)c(F)c(F)c(F)c2-3)c1F |
| InChI | InChI=1S/C13F9.C6H2F3.C6H3F2.Ga/c14-3-1-2-4(8(16)7(3)15)5-6(13(2,21)22)10(18)12(20)11(19)9(5)17;7-4-2-1-3-5(8)6(4)9;7-5-3-1-2-4-6(5)8;/h;1-2H;1-3H; |
| InChIKey | URZGPZPJPSNBGE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.01 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|