C15H3F9 — CID 173206122
1-(2,3-difluorophenyl)-1,2,3,4,5,6,7-heptafluoroindene (PubChem CID 173206122) has the molecular formula C15H3F9 and a molecular weight of 354.17 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-1,2,3,4,5,6,7-heptafluoroindene.
| Compound Name | 1-(2,3-difluorophenyl)-1,2,3,4,5,6,7-heptafluoroindene |
|---|---|
| PubChem CID | 173206122 |
| Molecular Formula | C15H3F9 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 1-(2,3-difluorophenyl)-1,2,3,4,5,6,7-heptafluoroindene |
| SMILES | FC1=C(F)C(F)(c2cccc(F)c2F)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C15H3F9/c16-5-3-1-2-4(8(5)17)15(24)7-6(10(19)14(15)23)9(18)12(21)13(22)11(7)20/h1-3H |
| InChIKey | RGPPIBWRTGCGKS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|