C37H4BF21O3 — CID 172700054
(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6-trifluoronaphthalen-1-yl) borate (PubChem CID 172700054) has the molecular formula C37H4BF21O3 and a molecular weight of 906.21 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6-trifluoronaphthalen-1-yl) borate.
| Compound Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6-trifluoronaphthalen-1-yl) borate |
|---|---|
| PubChem CID | 172700054 |
| Molecular Formula | C37H4BF21O3 |
| Molecular Weight | 906.21 g/mol |
| Exact Mass | 905.99 |
| IUPAC Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6-trifluoronaphthalen-1-yl) borate |
| SMILES | Fc1ccc2c(OB(Oc3c(F)c(F)c(F)c4c3C(F)(F)c3c(F)c(F)c(F)c(F)c3-4)Oc3c(F)c(F)c(F)c4c(F)c5c(F)c(F)c(F)c(F)c5c(F)c34)ccc(F)c2c1F |
| InChI | InChI=1S/C37H4BF21O3/c39-6-3-4-8(5-1-2-7(40)18(41)9(5)6)60-38(62-36-17-11(22(45)30(53)34(36)57)10-16(37(17,58)59)26(49)32(55)27(50)21(10)44)61-35-15-14(25(48)31(54)33(35)56)19(42)12-13(20(15)43)24(47)29(52)28(51)23(12)46/h1-4H |
| InChIKey | CVLSCKBWIZOZAS-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.21 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|