C36BF23O3 — CID 150254994
(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl) (2,3,4,5,6-pentafluorophenyl) borate (PubChem CID 150254994) has the molecular formula C36BF23O3 and a molecular weight of 928.16 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl) (2,3,4,5,6-pentafluorophenyl) borate.
| Compound Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl) (2,3,4,5,6-pentafluorophenyl) borate |
|---|---|
| PubChem CID | 150254994 |
| Molecular Formula | C36BF23O3 |
| Molecular Weight | 928.16 g/mol |
| Exact Mass | 927.96 |
| IUPAC Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl) (2,3,4,5,6-pentafluorophenyl) borate |
| SMILES | Fc1c(F)c(F)c(OB(Oc2c(F)c(F)c(F)c3c(F)c4c(F)c(F)c(F)c(F)c4c(F)c23)Oc2c(F)c(F)c3c(F)c(F)c4c(F)c(F)c(F)c5c(F)c(F)c2c3c45)c(F)c1F |
| InChI | InChI=1S/C36BF23O3/c38-11-6-7(19(46)25(52)24(51)18(6)45)12(39)10-8(11)20(47)26(53)31(58)35(10)62-37(63-36-32(59)28(55)27(54)29(56)33(36)60)61-34-9-2-1-3(13(40)14(41)5(2)21(48)30(34)57)16(43)23(50)17(44)4(1)15(42)22(9)49 |
| InChIKey | GAJGCHIORIWOTH-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.16 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|