C37H3BF22O3 — CID 151654204
(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) borate (PubChem CID 151654204) has the molecular formula C37H3BF22O3 and a molecular weight of 924.20 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) borate.
| Compound Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) borate |
|---|---|
| PubChem CID | 151654204 |
| Molecular Formula | C37H3BF22O3 |
| Molecular Weight | 924.20 g/mol |
| Exact Mass | 923.98 |
| IUPAC Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl) (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) borate |
| SMILES | Fc1cc2c(OB(Oc3c(F)c(F)c(F)c4c3C(F)(F)c3c(F)c(F)c(F)c(F)c3-4)Oc3c(F)c(F)c(F)c4c(F)c5c(F)c(F)c(F)c(F)c5c(F)c34)ccc(F)c2c(F)c1F |
| InChI | InChI=1S/C37H3BF22O3/c39-5-1-2-7(4-3-6(40)17(41)20(44)8(4)5)61-38(63-36-16-10(22(46)30(54)34(36)58)9-15(37(16,59)60)26(50)32(56)27(51)21(9)45)62-35-14-13(25(49)31(55)33(35)57)18(42)11-12(19(14)43)24(48)29(53)28(52)23(11)47/h1-3H |
| InChIKey | QVDGOQRSVHTESX-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.20 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|