C26H9BF10O3 — CID 139978246
(5,6,7,8-tetrafluoronaphthalen-1-yl) (4,5,7-trifluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate (PubChem CID 139978246) has the molecular formula C26H9BF10O3 and a molecular weight of 570.15 g/mol. Its IUPAC name is (5,6,7,8-tetrafluoronaphthalen-1-yl) (4,5,7-trifluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate.
| Compound Name | (5,6,7,8-tetrafluoronaphthalen-1-yl) (4,5,7-trifluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate |
|---|---|
| PubChem CID | 139978246 |
| Molecular Formula | C26H9BF10O3 |
| Molecular Weight | 570.15 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | (5,6,7,8-tetrafluoronaphthalen-1-yl) (4,5,7-trifluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate |
| SMILES | Fc1cc(F)c2c(F)ccc(OB(Oc3ccc(F)c(F)c3F)Oc3cccc4c(F)c(F)c(F)c(F)c34)c2c1 |
| InChI | InChI=1S/C26H9BF10O3/c28-10-8-12-16(6-4-13(29)19(12)15(31)9-10)38-27(40-18-7-5-14(30)22(33)23(18)34)39-17-3-1-2-11-20(17)24(35)26(37)25(36)21(11)32/h1-9H |
| InChIKey | RZXBDFLEIOQYRH-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.15 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|