C29H10BF11O3 — CID 139978253
(2,3,4,5-tetrafluoro-9H-fluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate (PubChem CID 139978253) has the molecular formula C29H10BF11O3 and a molecular weight of 626.19 g/mol. Its IUPAC name is (2,3,4,5-tetrafluoro-9H-fluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate.
| Compound Name | (2,3,4,5-tetrafluoro-9H-fluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate |
|---|---|
| PubChem CID | 139978253 |
| Molecular Formula | C29H10BF11O3 |
| Molecular Weight | 626.19 g/mol |
| Exact Mass | 626.05 |
| IUPAC Name | (2,3,4,5-tetrafluoro-9H-fluoren-1-yl) (4,5,6,7-tetrafluoronaphthalen-1-yl) (2,3,4-trifluorophenyl) borate |
| SMILES | Fc1ccc(OB(Oc2c(F)c(F)c(F)c3c2Cc2cccc(F)c2-3)Oc2ccc(F)c3c(F)c(F)c(F)cc23)c(F)c1F |
| InChI | InChI=1S/C29H10BF11O3/c31-13-3-1-2-10-8-12-21(19(10)13)26(39)27(40)28(41)29(12)44-30(43-18-7-5-15(33)22(35)24(18)37)42-17-6-4-14(32)20-11(17)9-16(34)23(36)25(20)38/h1-7,9H,8H2 |
| InChIKey | ODFUSZDTLBKWOR-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.19 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|