C46H11BF20O3 — CID 139989723
(2,4-difluorophenyl) bis[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluoronaphthalen-1-yl)naphthalen-1-yl] borate (PubChem CID 139989723) has the molecular formula C46H11BF20O3 and a molecular weight of 1002.36 g/mol. Its IUPAC name is (2,4-difluorophenyl) bis[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluoronaphthalen-1-yl)naphthalen-1-yl] borate.
| Compound Name | (2,4-difluorophenyl) bis[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluoronaphthalen-1-yl)naphthalen-1-yl] borate |
|---|---|
| PubChem CID | 139989723 |
| Molecular Formula | C46H11BF20O3 |
| Molecular Weight | 1002.36 g/mol |
| Exact Mass | 1002.05 |
| IUPAC Name | (2,4-difluorophenyl) bis[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluoronaphthalen-1-yl)naphthalen-1-yl] borate |
| SMILES | Fc1ccc(OB(Oc2c(F)c(F)c(F)c3c(F)c(-c4c(F)c(F)c(F)c5c(F)c(F)ccc45)ccc23)Oc2c(F)c(F)c(F)c3c(F)c(-c4c(F)c(F)c(F)c5c(F)c(F)ccc45)ccc23)c(F)c1 |
| InChI | InChI=1S/C46H11BF20O3/c48-12-1-10-22(21(51)11-12)68-47(69-45-17-4-2-15(29(52)27(17)37(60)41(64)43(45)66)23-13-6-8-19(49)31(54)25(13)35(58)39(62)33(23)56)70-46-18-5-3-16(30(53)28(18)38(61)42(65)44(46)67)24-14-7-9-20(50)32(55)26(14)36(59)40(63)34(24)57/h1-11H |
| InChIKey | KRXHSQBALKHCBQ-UHFFFAOYSA-N |
| XLogP | 14.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.36 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|