C26H7F11 — CID 87457689
9-(2,4-difluorophenyl)-1,2,3,4-tetrafluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene (PubChem CID 87457689) has the molecular formula C26H7F11 and a molecular weight of 528.32 g/mol. Its IUPAC name is 9-(2,4-difluorophenyl)-1,2,3,4-tetrafluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene.
| Compound Name | 9-(2,4-difluorophenyl)-1,2,3,4-tetrafluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene |
|---|---|
| PubChem CID | 87457689 |
| Molecular Formula | C26H7F11 |
| Molecular Weight | 528.32 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 9-(2,4-difluorophenyl)-1,2,3,4-tetrafluoro-10-(2,3,4,5,6-pentafluorophenyl)anthracene |
| SMILES | Fc1ccc(-c2c3ccccc3c(-c3c(F)c(F)c(F)c(F)c3F)c3c(F)c(F)c(F)c(F)c23)c(F)c1 |
| InChI | InChI=1S/C26H7F11/c27-8-5-6-11(12(28)7-8)13-9-3-1-2-4-10(9)14(16-15(13)18(29)22(33)23(34)19(16)30)17-20(31)24(35)26(37)25(36)21(17)32/h1-7H |
| InChIKey | JINFZLGFFRPUNV-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.32 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|