C28H5BF16O2 — CID 141052331
(2,5-difluorophenyl)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borane (PubChem CID 141052331) has the molecular formula C28H5BF16O2 and a molecular weight of 688.13 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borane.
| Compound Name | (2,5-difluorophenyl)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borane |
|---|---|
| PubChem CID | 141052331 |
| Molecular Formula | C28H5BF16O2 |
| Molecular Weight | 688.13 g/mol |
| Exact Mass | 688.01 |
| IUPAC Name | (2,5-difluorophenyl)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borane |
| SMILES | Fc1ccc(F)c(B(Oc2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c2F)Oc2c(F)c(F)c(F)c3c(F)c(F)ccc23)c1 |
| InChI | InChI=1S/C28H5BF16O2/c30-6-1-3-9(31)8(5-6)29(46-27-7-2-4-10(32)14(33)11(7)15(34)22(41)25(27)44)47-28-13(18(37)21(40)24(43)26(28)45)12-16(35)19(38)23(42)20(39)17(12)36/h1-5H |
| InChIKey | ARKHAZBDVIMRIL-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.13 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|