C25H8BF11O2 — CID 141052337
(3,4-difluorophenoxy)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane (PubChem CID 141052337) has the molecular formula C25H8BF11O2 and a molecular weight of 560.13 g/mol. Its IUPAC name is (3,4-difluorophenoxy)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane.
| Compound Name | (3,4-difluorophenoxy)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane |
|---|---|
| PubChem CID | 141052337 |
| Molecular Formula | C25H8BF11O2 |
| Molecular Weight | 560.13 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | (3,4-difluorophenoxy)-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane |
| SMILES | FC1=C(F)C(B(Oc2ccc(F)c(F)c2)Oc2c(F)c(F)c(F)c3c(F)c(F)ccc23)c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C25H8BF11O2/c27-11-4-1-8(7-14(11)30)38-26(17-9-2-5-12(28)18(31)15(9)20(33)22(17)35)39-25-10-3-6-13(29)19(32)16(10)21(34)23(36)24(25)37/h1-7,17H |
| InChIKey | DHGOHYIPNAFZKH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.13 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|