C10H6F4 — CID 126756473
2,3,4,5-tetrafluoro-1-methyl-1H-indene (PubChem CID 126756473) has the molecular formula C10H6F4 and a molecular weight of 202.15 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-1-methyl-1H-indene.
| Compound Name | 2,3,4,5-tetrafluoro-1-methyl-1H-indene |
|---|---|
| PubChem CID | 126756473 |
| Molecular Formula | C10H6F4 |
| Molecular Weight | 202.15 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2,3,4,5-tetrafluoro-1-methyl-1H-indene |
| SMILES | CC1C(F)=C(F)c2c1ccc(F)c2F |
| InChI | InChI=1S/C10H6F4/c1-4-5-2-3-6(11)9(13)7(5)10(14)8(4)12/h2-4H,1H3 |
| InChIKey | KKQDFLSKFRSGGS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |