C9H5BF4O2 — CID 141052406
(2,3,4,5-tetrafluoro-1H-inden-1-yl)boronic acid (PubChem CID 141052406) has the molecular formula C9H5BF4O2 and a molecular weight of 231.94 g/mol. Its IUPAC name is (2,3,4,5-tetrafluoro-1H-inden-1-yl)boronic acid.
| Compound Name | (2,3,4,5-tetrafluoro-1H-inden-1-yl)boronic acid |
|---|---|
| PubChem CID | 141052406 |
| Molecular Formula | C9H5BF4O2 |
| Molecular Weight | 231.94 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (2,3,4,5-tetrafluoro-1H-inden-1-yl)boronic acid |
| SMILES | OB(O)C1C(F)=C(F)c2c1ccc(F)c2F |
| InChI | InChI=1S/C9H5BF4O2/c11-4-2-1-3-5(7(4)12)8(13)9(14)6(3)10(15)16/h1-2,6,15-16H |
| InChIKey | LBNAQMVRHUBJEF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.94 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|