C12H4F8 — CID 71775255
1,2,4,5,6-pentafluoro-3-(2,3,4-trifluorophenyl)cyclohexa-1,3-diene (PubChem CID 71775255) has the molecular formula C12H4F8 and a molecular weight of 300.15 g/mol. Its IUPAC name is 1,2,4,5,6-pentafluoro-3-(2,3,4-trifluorophenyl)cyclohexa-1,3-diene.
| Compound Name | 1,2,4,5,6-pentafluoro-3-(2,3,4-trifluorophenyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 71775255 |
| Molecular Formula | C12H4F8 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 1,2,4,5,6-pentafluoro-3-(2,3,4-trifluorophenyl)cyclohexa-1,3-diene |
| SMILES | FC1=C(F)C(F)C(F)C(F)=C1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H4F8/c13-4-2-1-3(6(14)7(4)15)5-8(16)10(18)12(20)11(19)9(5)17/h1-2,10,12H |
| InChIKey | WWWQVFBZASOBCJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|