C12H6F3NO2 — CID 141419715
1,2,3-trifluoro-4-(2-nitrophenyl)benzene (PubChem CID 141419715) has the molecular formula C12H6F3NO2 and a molecular weight of 253.18 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-(2-nitrophenyl)benzene.
| Compound Name | 1,2,3-trifluoro-4-(2-nitrophenyl)benzene |
|---|---|
| PubChem CID | 141419715 |
| Molecular Formula | C12H6F3NO2 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 1,2,3-trifluoro-4-(2-nitrophenyl)benzene |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H6F3NO2/c13-9-6-5-8(11(14)12(9)15)7-3-1-2-4-10(7)16(17)18/h1-6H |
| InChIKey | YMPGNSSFQCAMJW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|