C12H5F3N4O2 — CID 82566584
8-nitro-2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 82566584) has the molecular formula C12H5F3N4O2 and a molecular weight of 294.19 g/mol. Its IUPAC name is 8-nitro-2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-nitro-2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 82566584 |
| Molecular Formula | C12H5F3N4O2 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 8-nitro-2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | O=[N+]([O-])c1cccn2nc(-c3ccc(F)c(F)c3F)nc12 |
| InChI | InChI=1S/C12H5F3N4O2/c13-7-4-3-6(9(14)10(7)15)11-16-12-8(19(20)21)2-1-5-18(12)17-11/h1-5H |
| InChIKey | MEFRQPBXKLNNIP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|