C13H6F3N5O3 — CID 110455353
2,3,4-trifluoro-N-(8-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzamide (PubChem CID 110455353) has the molecular formula C13H6F3N5O3 and a molecular weight of 337.22 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(8-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzamide.
| Compound Name | 2,3,4-trifluoro-N-(8-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 110455353 |
| Molecular Formula | C13H6F3N5O3 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2,3,4-trifluoro-N-(8-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzamide |
| SMILES | O=C(Nc1nc2c([N+](=O)[O-])cccn2n1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H6F3N5O3/c14-7-4-3-6(9(15)10(7)16)12(22)18-13-17-11-8(21(23)24)2-1-5-20(11)19-13/h1-5H,(H,18,19,22) |
| InChIKey | CKBAHTZFOYKNLP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|