C18H10F3N5O — CID 113051140
N-[6-(2-cyanoanilino)pyridazin-3-yl]-2,3,4-trifluorobenzamide (PubChem CID 113051140) has the molecular formula C18H10F3N5O and a molecular weight of 369.31 g/mol. Its IUPAC name is N-[6-(2-cyanoanilino)pyridazin-3-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[6-(2-cyanoanilino)pyridazin-3-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 113051140 |
| Molecular Formula | C18H10F3N5O |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[6-(2-cyanoanilino)pyridazin-3-yl]-2,3,4-trifluorobenzamide |
| SMILES | N#Cc1ccccc1Nc1ccc(NC(=O)c2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C18H10F3N5O/c19-12-6-5-11(16(20)17(12)21)18(27)24-15-8-7-14(25-26-15)23-13-4-2-1-3-10(13)9-22/h1-8H,(H,23,25)(H,24,26,27) |
| InChIKey | XQVXEJDCGUYTCS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|