C18H11F2N5O — CID 113051139
N-[6-(2-cyanoanilino)pyridazin-3-yl]-3,4-difluorobenzamide (PubChem CID 113051139) has the molecular formula C18H11F2N5O and a molecular weight of 351.32 g/mol. Its IUPAC name is N-[6-(2-cyanoanilino)pyridazin-3-yl]-3,4-difluorobenzamide.
| Compound Name | N-[6-(2-cyanoanilino)pyridazin-3-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113051139 |
| Molecular Formula | C18H11F2N5O |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[6-(2-cyanoanilino)pyridazin-3-yl]-3,4-difluorobenzamide |
| SMILES | N#Cc1ccccc1Nc1ccc(NC(=O)c2ccc(F)c(F)c2)nn1 |
| InChI | InChI=1S/C18H11F2N5O/c19-13-6-5-11(9-14(13)20)18(26)23-17-8-7-16(24-25-17)22-15-4-2-1-3-12(15)10-21/h1-9H,(H,22,24)(H,23,25,26) |
| InChIKey | WYDLORPWAZNQPF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |