C17H12N6O — CID 113051134
N-[6-(2-cyanoanilino)pyridazin-3-yl]pyridine-3-carboxamide (PubChem CID 113051134) has the molecular formula C17H12N6O and a molecular weight of 316.32 g/mol. Its IUPAC name is N-[6-(2-cyanoanilino)pyridazin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[6-(2-cyanoanilino)pyridazin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113051134 |
| Molecular Formula | C17H12N6O |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[6-(2-cyanoanilino)pyridazin-3-yl]pyridine-3-carboxamide |
| SMILES | N#Cc1ccccc1Nc1ccc(NC(=O)c2cccnc2)nn1 |
| InChI | InChI=1S/C17H12N6O/c18-10-12-4-1-2-6-14(12)20-15-7-8-16(23-22-15)21-17(24)13-5-3-9-19-11-13/h1-9,11H,(H,20,22)(H,21,23,24) |
| InChIKey | GEWQKSKKLPIRRC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |