C17H9F5N4O3 — CID 19286696
2-nitro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286696) has the molecular formula C17H9F5N4O3 and a molecular weight of 412.27 g/mol. Its IUPAC name is 2-nitro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 2-nitro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286696 |
| Molecular Formula | C17H9F5N4O3 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-nitro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H9F5N4O3/c18-12-9(13(19)15(21)16(22)14(12)20)7-25-6-5-11(24-25)23-17(27)8-3-1-2-4-10(8)26(28)29/h1-6H,7H2,(H,23,24,27) |
| InChIKey | SJOKTJWMNIMHSC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|