C21H8BF9O2 — CID 141052492
(2,5-difluorophenoxy)-[(2,3,4,5-tetrafluoro-1H-inden-1-yl)oxy]-(2,3,4-trifluorophenyl)borane (PubChem CID 141052492) has the molecular formula C21H8BF9O2 and a molecular weight of 474.09 g/mol. Its IUPAC name is (2,5-difluorophenoxy)-[(2,3,4,5-tetrafluoro-1H-inden-1-yl)oxy]-(2,3,4-trifluorophenyl)borane.
| Compound Name | (2,5-difluorophenoxy)-[(2,3,4,5-tetrafluoro-1H-inden-1-yl)oxy]-(2,3,4-trifluorophenyl)borane |
|---|---|
| PubChem CID | 141052492 |
| Molecular Formula | C21H8BF9O2 |
| Molecular Weight | 474.09 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | (2,5-difluorophenoxy)-[(2,3,4,5-tetrafluoro-1H-inden-1-yl)oxy]-(2,3,4-trifluorophenyl)borane |
| SMILES | FC1=C(F)C(OB(Oc2cc(F)ccc2F)c2ccc(F)c(F)c2F)c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C21H8BF9O2/c23-8-1-4-11(24)14(7-8)32-22(10-3-6-13(26)18(29)16(10)27)33-21-9-2-5-12(25)17(28)15(9)19(30)20(21)31/h1-7,21H |
| InChIKey | NTNZNTKUBTXXHU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.09 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|